描述
Pyroglutamic acid, also known as pyroglutamate or (-)-2-pyrrolidone-5-carboxylic acid, belongs to alpha amino acids and derivatives class of compounds. Those are amino acids in which the amino group is attached to the carbon atom immediately adjacent to the carboxylate group (alpha carbon), or a derivative thereof. Pyroglutamic acid is soluble (in water) and a weakly acidic compound (based on its pKa). Pyroglutamic acid can be found in a number of food items such as sesame, mexican groundcherry, sorghum, and breakfast cereal, which makes pyroglutamic acid a potential biomarker for the consumption of these food products. Pyroglutamic acid can be found primarily in most biofluids, including blood, feces, urine, and saliva, as well as in human brain, prostate and skin tissues. Pyroglutamic acid exists in all eukaryotes, ranging from yeast to humans. In humans, pyroglutamic acid is involved in the glutathione metabolism. Pyroglutamic acid is also involved in several metabolic disorders, some of which include 5-Oxoprolinuria, gamma-glutamyltransferase deficiency, gamma-glutamyl-transpeptidase deficiency, and glutathione synthetase deficiency. Moreover, pyroglutamic acid is found to be associated with schizophrenia, glutathione synthetase deficiency, and 5-oxoprolinase deficiency. Pyroglutamic acid is a non-carcinogenic (not listed by IARC) potentially toxic compound.
InChI标识符
InChI=1S/C5H7NO3/c7-4-2-1-3(6-4)5(8)9/h3H,1-2H2,(H,6,7)(H,8,9)/t3-/m0/s1