描述
3-hydroxypyruvic acid, also known as beta-hydroxypyruvate or oh-pyr, belongs to beta hydroxy acids and derivatives class of compounds. Those are compounds containing a carboxylic acid substituted with a hydroxyl group on the C3 carbon atom. 3-hydroxypyruvic acid is soluble (in water) and a moderately acidic compound (based on its pKa). 3-hydroxypyruvic acid can be found in a number of food items such as fox grape, black mulberry, elliott's blueberry, and silver linden, which makes 3-hydroxypyruvic acid a potential biomarker for the consumption of these food products. 3-hydroxypyruvic acid can be found primarily in blood and urine. 3-hydroxypyruvic acid exists in all living organisms, ranging from bacteria to humans. In humans, 3-hydroxypyruvic acid is involved in the glycine and serine metabolism. 3-hydroxypyruvic acid is also involved in several metabolic disorders, some of which include dihydropyrimidine dehydrogenase deficiency (DHPD), 3-phosphoglycerate dehydrogenase deficiency, hyperglycinemia, non-ketotic, and non ketotic hyperglycinemia. Hydroxypyruvic acid is a pyruvic acid derivative with the formula C3H4O4 and a neutral charge with an atomic mass of 104.06146 .
InChI标识符
InChI=1S/C3H4O4/c4-1-2(5)3(6)7/h4H,1H2,(H,6,7)