描述
Ureidoisobutyric acid, also known as 3-ureidoisobutyrate or beta-uba, is a member of the class of compounds known as ureas. Ureas are compounds containing two amine groups joined by a carbonyl (C=O) functional group. Ureidoisobutyric acid is soluble (in water) and a weakly acidic compound (based on its pKa). Ureidoisobutyric acid can be found in a number of food items such as pili nut, breakfast cereal, bitter gourd, and scarlet bean, which makes ureidoisobutyric acid a potential biomarker for the consumption of these food products. Ureidoisobutyric acid can be found primarily in blood, cerebrospinal fluid (CSF), and urine. Ureidoisobutyric acid exists in all living organisms, ranging from bacteria to humans. In humans, ureidoisobutyric acid is involved in the pyrimidine metabolism. Ureidoisobutyric acid is also involved in few metabolic disorders, which include beta ureidopropionase deficiency, dihydropyrimidinase deficiency, MNGIE (mitochondrial neurogastrointestinal encephalopathy), and UMP synthase deficiency (orotic aciduria). Moreover, ureidoisobutyric acid is found to be associated with beta-ureidopropionase deficiency.
InChI标识符
InChI=1S/C5H10N2O3/c1-3(4(8)9)2-7-5(6)10/h3H,2H2,1H3,(H,8,9)(H3,6,7,10)