描述
(s)-b-aminoisobutyric acid, also known as (S)-3-amino-2-methylpropanoic acid or L-3-amino-isobutanoate, belongs to beta amino acids and derivatives class of compounds. Those are amino acids having a (-NH2) group attached to the beta carbon atom. Thus, (s)-b-aminoisobutyric acid is considered to be a fatty acid lipid molecule (s)-b-aminoisobutyric acid is soluble (in water) and a weakly acidic compound (based on its pKa). (s)-b-aminoisobutyric acid can be found in a number of food items such as canada blueberry, sea-buckthornberry, groundcherry, and oriental wheat, which makes (s)-b-aminoisobutyric acid a potential biomarker for the consumption of these food products (s)-b-aminoisobutyric acid can be found primarily in blood, feces, and urine (s)-b-aminoisobutyric acid exists in all living organisms, ranging from bacteria to humans. In humans, (s)-b-aminoisobutyric acid is involved in the valine, leucine and isoleucine degradation (s)-b-aminoisobutyric acid is also involved in several metabolic disorders, some of which include isobutyryl-coa dehydrogenase deficiency, 3-hydroxyisobutyric aciduria, 3-methylglutaconic aciduria type I, and methylmalonic aciduria.
InChI标识符
InChI=1S/C4H9NO2/c1-3(2-5)4(6)7/h3H,2,5H2,1H3,(H,6,7)/t3-/m0/s1